C13H17N3 — CID 129200359
N'-(4-methyl-1,2,3,6-tetrahydropyridin-5-yl)-N-phenylmethanimidamide (PubChem CID 129200359) has the molecular formula C13H17N3 and a molecular weight of 215.30 g/mol. Its IUPAC name is N'-(4-methyl-1,2,3,6-tetrahydropyridin-5-yl)-N-phenylmethanimidamide.
| Compound Name | N'-(4-methyl-1,2,3,6-tetrahydropyridin-5-yl)-N-phenylmethanimidamide |
|---|---|
| PubChem CID | 129200359 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | N'-(4-methyl-1,2,3,6-tetrahydropyridin-5-yl)-N-phenylmethanimidamide |
| SMILES | CC1=C(/N=C/Nc2ccccc2)CNCC1 |
| InChI | InChI=1S/C13H17N3/c1-11-7-8-14-9-13(11)16-10-15-12-5-3-2-4-6-12/h2-6,10,14H,7-9H2,1H3,(H,15,16) |
| InChIKey | VRPCBVMQWICQOP-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|