About 6-ethyl-2,5-dimethyl-2,3-dihydro-1,4-dithiine
6-ethyl-2,5-dimethyl-2,3-dihydro-1,4-dithiine (PubChem CID 12920056) has the molecular formula C8H14S2
and a molecular weight of 174.33 g/mol. Its IUPAC name is 6-ethyl-2,5-dimethyl-2,3-dihydro-1,4-dithiine.
Molecular Properties
| Compound Name | 6-ethyl-2,5-dimethyl-2,3-dihydro-1,4-dithiine |
| PubChem CID | 12920056 |
| Molecular Formula | C8H14S2 |
| Molecular Weight | 174.33 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | 6-ethyl-2,5-dimethyl-2,3-dihydro-1,4-dithiine |
| SMILES | CCC1=C(C)SCC(C)S1 |
| InChI | InChI=1S/C8H14S2/c1-4-8-7(3)9-5-6(2)10-8/h6H,4-5H2,1-3H3 |
| InChIKey | ZNGAOYXHONGTEK-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.33 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-ethyl-2,5-dimethyl-2,3-dihydro-1,4-dithiine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-2,5-dimethyl-2,3-dihydro-1,4-dithiine?
The IUPAC name of 6-ethyl-2,5-dimethyl-2,3-dihydro-1,4-dithiine (CID 12920056) is 6-ethyl-2,5-dimethyl-2,3-dihydro-1,4-dithiine.
What is the SMILES notation for 6-ethyl-2,5-dimethyl-2,3-dihydro-1,4-dithiine?
The canonical SMILES for 6-ethyl-2,5-dimethyl-2,3-dihydro-1,4-dithiine is CCC1=C(C)SCC(C)S1.
What is the InChIKey of 6-ethyl-2,5-dimethyl-2,3-dihydro-1,4-dithiine?
The InChIKey is ZNGAOYXHONGTEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14S2/c1-4-8-7(3)9-5-6(2)10-8/h6H,4-5H2,1-3H3.
What are the key properties of 6-ethyl-2,5-dimethyl-2,3-dihydro-1,4-dithiine?
6-ethyl-2,5-dimethyl-2,3-dihydro-1,4-dithiine has a molecular weight of 174.33 g/mol, XLogP of 3.50, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-2,5-dimethyl-2,3-dihydro-1,4-dithiine is sourced from PubChem (CID 12920056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).