C10H16S2 — CID 12920065
2,3-dimethyl-4a,5,6,7,8,8a-hexahydro-1,4-benzodithiine (PubChem CID 12920065) has the molecular formula C10H16S2 and a molecular weight of 200.37 g/mol. Its IUPAC name is 2,3-dimethyl-4a,5,6,7,8,8a-hexahydro-1,4-benzodithiine.
| Compound Name | 2,3-dimethyl-4a,5,6,7,8,8a-hexahydro-1,4-benzodithiine |
|---|---|
| PubChem CID | 12920065 |
| Molecular Formula | C10H16S2 |
| Molecular Weight | 200.37 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 2,3-dimethyl-4a,5,6,7,8,8a-hexahydro-1,4-benzodithiine |
| SMILES | CC1=C(C)SC2CCCCC2S1 |
| InChI | InChI=1S/C10H16S2/c1-7-8(2)12-10-6-4-3-5-9(10)11-7/h9-10H,3-6H2,1-2H3 |
| InChIKey | MTMIHZUXVAFJRO-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.37 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |