C8H6N2 — CID 129201220
3,8-diazabicyclo[5.3.0]deca-1,3,4,6,9-pentaene (PubChem CID 129201220) has the molecular formula C8H6N2 and a molecular weight of 130.15 g/mol. Its IUPAC name is 3,8-diazabicyclo[5.3.0]deca-1,3,4,6,9-pentaene.
| Compound Name | 3,8-diazabicyclo[5.3.0]deca-1,3,4,6,9-pentaene |
|---|---|
| PubChem CID | 129201220 |
| Molecular Formula | C8H6N2 |
| Molecular Weight | 130.15 g/mol |
| Exact Mass | 130.05 |
| IUPAC Name | 3,8-diazabicyclo[5.3.0]deca-1,3,4,6,9-pentaene |
| SMILES | C1=CC=c2[nH]ccc2=CN=1 |
| InChI | InChI=1S/C8H6N2/c1-2-8-7(3-5-10-8)6-9-4-1/h1-3,5-6,10H |
| InChIKey | DPBHOPOUNGCGBA-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 28.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.15 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |