About 2,5-diazabicyclo[5.4.0]undeca-1,3,4,6,8,10-hexaene
2,5-diazabicyclo[5.4.0]undeca-1,3,4,6,8,10-hexaene (PubChem CID 129201413) has the molecular formula C9H6N2
and a molecular weight of 142.16 g/mol. Its IUPAC name is 2,5-diazabicyclo[5.4.0]undeca-1,3,4,6,8,10-hexaene.
Analyze 2,5-diazabicyclo[5.4.0]undeca-1,3,4,6,8,10-hexaene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-diazabicyclo[5.4.0]undeca-1,3,4,6,8,10-hexaene?
The IUPAC name of 2,5-diazabicyclo[5.4.0]undeca-1,3,4,6,8,10-hexaene (CID 129201413) is 2,5-diazabicyclo[5.4.0]undeca-1,3,4,6,8,10-hexaene.
What is the SMILES notation for 2,5-diazabicyclo[5.4.0]undeca-1,3,4,6,8,10-hexaene?
The canonical SMILES for 2,5-diazabicyclo[5.4.0]undeca-1,3,4,6,8,10-hexaene is C1=CN=c2ccccc2=CN=1.
What is the InChIKey of 2,5-diazabicyclo[5.4.0]undeca-1,3,4,6,8,10-hexaene?
The InChIKey is CLJFDAYAPBKUJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2/c1-2-4-9-8(3-1)7-10-5-6-11-9/h1-4,6-7H.
What are the key properties of 2,5-diazabicyclo[5.4.0]undeca-1,3,4,6,8,10-hexaene?
2,5-diazabicyclo[5.4.0]undeca-1,3,4,6,8,10-hexaene has a molecular weight of 142.16 g/mol, XLogP of 0.24, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-diazabicyclo[5.4.0]undeca-1,3,4,6,8,10-hexaene is sourced from PubChem (CID 129201413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).