About [3-(2-methylpropyl)-1,2-oxazol-5-yl]methanol
[3-(2-methylpropyl)-1,2-oxazol-5-yl]methanol (PubChem CID 12920234) has the molecular formula C8H13NO2
and a molecular weight of 155.20 g/mol. Its IUPAC name is [3-(2-methylpropyl)-1,2-oxazol-5-yl]methanol.
Molecular Properties
| Compound Name | [3-(2-methylpropyl)-1,2-oxazol-5-yl]methanol |
| PubChem CID | 12920234 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | [3-(2-methylpropyl)-1,2-oxazol-5-yl]methanol |
| SMILES | CC(C)Cc1cc(CO)on1 |
| InChI | InChI=1S/C8H13NO2/c1-6(2)3-7-4-8(5-10)11-9-7/h4,6,10H,3,5H2,1-2H3 |
| InChIKey | PFZOTJPIMHFDHO-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [3-(2-methylpropyl)-1,2-oxazol-5-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(2-methylpropyl)-1,2-oxazol-5-yl]methanol?
The IUPAC name of [3-(2-methylpropyl)-1,2-oxazol-5-yl]methanol (CID 12920234) is [3-(2-methylpropyl)-1,2-oxazol-5-yl]methanol.
What is the SMILES notation for [3-(2-methylpropyl)-1,2-oxazol-5-yl]methanol?
The canonical SMILES for [3-(2-methylpropyl)-1,2-oxazol-5-yl]methanol is CC(C)Cc1cc(CO)on1.
What is the InChIKey of [3-(2-methylpropyl)-1,2-oxazol-5-yl]methanol?
The InChIKey is PFZOTJPIMHFDHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO2/c1-6(2)3-7-4-8(5-10)11-9-7/h4,6,10H,3,5H2,1-2H3.
What are the key properties of [3-(2-methylpropyl)-1,2-oxazol-5-yl]methanol?
[3-(2-methylpropyl)-1,2-oxazol-5-yl]methanol has a molecular weight of 155.20 g/mol, XLogP of 1.37, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(2-methylpropyl)-1,2-oxazol-5-yl]methanol is sourced from PubChem (CID 12920234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).