C26H30FNO2 — CID 129203316
N-[(3E)-6-ethyl-8-(3-fluorophenyl)-3,4-dimethyl-8-oxoocta-1,3-dien-2-yl]-4-methylbenzamide (PubChem CID 129203316) has the molecular formula C26H30FNO2 and a molecular weight of 407.53 g/mol. Its IUPAC name is N-[(3E)-6-ethyl-8-(3-fluorophenyl)-3,4-dimethyl-8-oxoocta-1,3-dien-2-yl]-4-methylbenzamide.
| Compound Name | N-[(3E)-6-ethyl-8-(3-fluorophenyl)-3,4-dimethyl-8-oxoocta-1,3-dien-2-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 129203316 |
| Molecular Formula | C26H30FNO2 |
| Molecular Weight | 407.53 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | N-[(3E)-6-ethyl-8-(3-fluorophenyl)-3,4-dimethyl-8-oxoocta-1,3-dien-2-yl]-4-methylbenzamide |
| SMILES | C=C(NC(=O)c1ccc(C)cc1)/C(C)=C(\C)CC(CC)CC(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C26H30FNO2/c1-6-21(15-25(29)23-8-7-9-24(27)16-23)14-18(3)19(4)20(5)28-26(30)22-12-10-17(2)11-13-22/h7-13,16,21H,5-6,14-15H2,1-4H3,(H,28,30)/b19-18+ |
| InChIKey | AULSHGKFQVWKHJ-VHEBQXMUSA-N |
| XLogP | 6.40 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.53 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|