About 1-(3-methyl-1,2-oxazol-5-yl)ethyl N-cyclohexylcarbamate
1-(3-methyl-1,2-oxazol-5-yl)ethyl N-cyclohexylcarbamate (PubChem CID 12920332) has the molecular formula C13H20N2O3
and a molecular weight of 252.31 g/mol. Its IUPAC name is 1-(3-methyl-1,2-oxazol-5-yl)ethyl N-cyclohexylcarbamate.
Molecular Properties
| Compound Name | 1-(3-methyl-1,2-oxazol-5-yl)ethyl N-cyclohexylcarbamate |
| PubChem CID | 12920332 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 1-(3-methyl-1,2-oxazol-5-yl)ethyl N-cyclohexylcarbamate |
| SMILES | Cc1cc(C(C)OC(=O)NC2CCCCC2)on1 |
| InChI | InChI=1S/C13H20N2O3/c1-9-8-12(18-15-9)10(2)17-13(16)14-11-6-4-3-5-7-11/h8,10-11H,3-7H2,1-2H3,(H,14,16) |
| InChIKey | ONJNIVOFGJDWDG-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(3-methyl-1,2-oxazol-5-yl)ethyl N-cyclohexylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-methyl-1,2-oxazol-5-yl)ethyl N-cyclohexylcarbamate?
The IUPAC name of 1-(3-methyl-1,2-oxazol-5-yl)ethyl N-cyclohexylcarbamate (CID 12920332) is 1-(3-methyl-1,2-oxazol-5-yl)ethyl N-cyclohexylcarbamate.
What is the SMILES notation for 1-(3-methyl-1,2-oxazol-5-yl)ethyl N-cyclohexylcarbamate?
The canonical SMILES for 1-(3-methyl-1,2-oxazol-5-yl)ethyl N-cyclohexylcarbamate is Cc1cc(C(C)OC(=O)NC2CCCCC2)on1.
What is the InChIKey of 1-(3-methyl-1,2-oxazol-5-yl)ethyl N-cyclohexylcarbamate?
The InChIKey is ONJNIVOFGJDWDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O3/c1-9-8-12(18-15-9)10(2)17-13(16)14-11-6-4-3-5-7-11/h8,10-11H,3-7H2,1-2H3,(H,14,16).
What are the key properties of 1-(3-methyl-1,2-oxazol-5-yl)ethyl N-cyclohexylcarbamate?
1-(3-methyl-1,2-oxazol-5-yl)ethyl N-cyclohexylcarbamate has a molecular weight of 252.31 g/mol, XLogP of 3.10, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-methyl-1,2-oxazol-5-yl)ethyl N-cyclohexylcarbamate is sourced from PubChem (CID 12920332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).