C21H19ClN2 — CID 12920353
2,4-diphenyl-4,5-dihydro-1H-1,3-benzodiazepine;hydrochloride (PubChem CID 12920353) has the molecular formula C21H19ClN2 and a molecular weight of 334.85 g/mol. Its IUPAC name is 2,4-diphenyl-4,5-dihydro-1H-1,3-benzodiazepine;hydrochloride.
| Compound Name | 2,4-diphenyl-4,5-dihydro-1H-1,3-benzodiazepine;hydrochloride |
|---|---|
| PubChem CID | 12920353 |
| Molecular Formula | C21H19ClN2 |
| Molecular Weight | 334.85 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 2,4-diphenyl-4,5-dihydro-1H-1,3-benzodiazepine;hydrochloride |
| SMILES | Cl.c1ccc(C2=NC(c3ccccc3)Cc3ccccc3N2)cc1 |
| InChI | InChI=1S/C21H18N2.ClH/c1-3-9-16(10-4-1)20-15-18-13-7-8-14-19(18)22-21(23-20)17-11-5-2-6-12-17;/h1-14,20H,15H2,(H,22,23);1H |
| InChIKey | CIGWDIBYPQSIOS-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.85 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |