About (5S)-5-aminooxan-3-one
(5S)-5-aminooxan-3-one (PubChem CID 129203799) has the molecular formula C5H9NO2
and a molecular weight of 115.13 g/mol. Its IUPAC name is (5S)-5-aminooxan-3-one.
Molecular Properties
| Compound Name | (5S)-5-aminooxan-3-one |
| PubChem CID | 129203799 |
| Molecular Formula | C5H9NO2 |
| Molecular Weight | 115.13 g/mol |
| Exact Mass | 115.06 |
| IUPAC Name | (5S)-5-aminooxan-3-one |
| SMILES | N[C@@H]1COCC(=O)C1 |
| InChI | InChI=1S/C5H9NO2/c6-4-1-5(7)3-8-2-4/h4H,1-3,6H2/t4-/m0/s1 |
| InChIKey | PJZHGCUHRYJWSX-BYPYZUCNSA-N |
| XLogP | -0.70 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.13 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5S)-5-aminooxan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-aminooxan-3-one?
The IUPAC name of (5S)-5-aminooxan-3-one (CID 129203799) is (5S)-5-aminooxan-3-one.
What is the SMILES notation for (5S)-5-aminooxan-3-one?
The canonical SMILES for (5S)-5-aminooxan-3-one is N[C@@H]1COCC(=O)C1.
What is the InChIKey of (5S)-5-aminooxan-3-one?
The InChIKey is PJZHGCUHRYJWSX-BYPYZUCNSA-N. The full InChI is InChI=1S/C5H9NO2/c6-4-1-5(7)3-8-2-4/h4H,1-3,6H2/t4-/m0/s1.
What are the key properties of (5S)-5-aminooxan-3-one?
(5S)-5-aminooxan-3-one has a molecular weight of 115.13 g/mol, XLogP of -0.70, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-aminooxan-3-one is sourced from PubChem (CID 129203799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).