About 3-(2,2-difluoropiperidin-1-yl)propanal
3-(2,2-difluoropiperidin-1-yl)propanal (PubChem CID 129204965) has the molecular formula C8H13F2NO
and a molecular weight of 177.19 g/mol. Its IUPAC name is 3-(2,2-difluoropiperidin-1-yl)propanal.
Molecular Properties
| Compound Name | 3-(2,2-difluoropiperidin-1-yl)propanal |
| PubChem CID | 129204965 |
| Molecular Formula | C8H13F2NO |
| Molecular Weight | 177.19 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | 3-(2,2-difluoropiperidin-1-yl)propanal |
| SMILES | O=CCCN1CCCCC1(F)F |
| InChI | InChI=1S/C8H13F2NO/c9-8(10)4-1-2-5-11(8)6-3-7-12/h7H,1-6H2 |
| InChIKey | AKJQQAOPDVQWRU-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.19 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,2-difluoropiperidin-1-yl)propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,2-difluoropiperidin-1-yl)propanal?
The IUPAC name of 3-(2,2-difluoropiperidin-1-yl)propanal (CID 129204965) is 3-(2,2-difluoropiperidin-1-yl)propanal.
What is the SMILES notation for 3-(2,2-difluoropiperidin-1-yl)propanal?
The canonical SMILES for 3-(2,2-difluoropiperidin-1-yl)propanal is O=CCCN1CCCCC1(F)F.
What is the InChIKey of 3-(2,2-difluoropiperidin-1-yl)propanal?
The InChIKey is AKJQQAOPDVQWRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13F2NO/c9-8(10)4-1-2-5-11(8)6-3-7-12/h7H,1-6H2.
What are the key properties of 3-(2,2-difluoropiperidin-1-yl)propanal?
3-(2,2-difluoropiperidin-1-yl)propanal has a molecular weight of 177.19 g/mol, XLogP of 1.65, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,2-difluoropiperidin-1-yl)propanal is sourced from PubChem (CID 129204965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).