About 2-formamido-N'-methyl-N-(1H-pyrazol-5-yl)butanediamide
2-formamido-N'-methyl-N-(1H-pyrazol-5-yl)butanediamide (PubChem CID 129205004) has the molecular formula C9H13N5O3
and a molecular weight of 239.24 g/mol. Its IUPAC name is 2-formamido-N'-methyl-N-(1H-pyrazol-5-yl)butanediamide.
Molecular Properties
| Compound Name | 2-formamido-N'-methyl-N-(1H-pyrazol-5-yl)butanediamide |
| PubChem CID | 129205004 |
| Molecular Formula | C9H13N5O3 |
| Molecular Weight | 239.24 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | 2-formamido-N'-methyl-N-(1H-pyrazol-5-yl)butanediamide |
| SMILES | CNC(=O)CC(NC=O)C(=O)Nc1ccn[nH]1 |
| InChI | InChI=1S/C9H13N5O3/c1-10-8(16)4-6(11-5-15)9(17)13-7-2-3-12-14-7/h2-3,5-6H,4H2,1H3,(H,10,16)(H,11,15)(H2,12,13,14,17) |
| InChIKey | NZSGJLJMWFIGLB-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 115.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.24 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-formamido-N'-methyl-N-(1H-pyrazol-5-yl)butanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-formamido-N'-methyl-N-(1H-pyrazol-5-yl)butanediamide?
The IUPAC name of 2-formamido-N'-methyl-N-(1H-pyrazol-5-yl)butanediamide (CID 129205004) is 2-formamido-N'-methyl-N-(1H-pyrazol-5-yl)butanediamide.
What is the SMILES notation for 2-formamido-N'-methyl-N-(1H-pyrazol-5-yl)butanediamide?
The canonical SMILES for 2-formamido-N'-methyl-N-(1H-pyrazol-5-yl)butanediamide is CNC(=O)CC(NC=O)C(=O)Nc1ccn[nH]1.
What is the InChIKey of 2-formamido-N'-methyl-N-(1H-pyrazol-5-yl)butanediamide?
The InChIKey is NZSGJLJMWFIGLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N5O3/c1-10-8(16)4-6(11-5-15)9(17)13-7-2-3-12-14-7/h2-3,5-6H,4H2,1H3,(H,10,16)(H,11,15)(H2,12,13,14,17).
What are the key properties of 2-formamido-N'-methyl-N-(1H-pyrazol-5-yl)butanediamide?
2-formamido-N'-methyl-N-(1H-pyrazol-5-yl)butanediamide has a molecular weight of 239.24 g/mol, XLogP of -1.40, 6 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-formamido-N'-methyl-N-(1H-pyrazol-5-yl)butanediamide is sourced from PubChem (CID 129205004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).