C18H30O6 — CID 129205019
9,12-bis(2-hydroxyethoxy)-3,6-dimethyldodeca-4,10-diyne-3,6-diol (PubChem CID 129205019) has the molecular formula C18H30O6 and a molecular weight of 342.43 g/mol. Its IUPAC name is 9,12-bis(2-hydroxyethoxy)-3,6-dimethyldodeca-4,10-diyne-3,6-diol.
| Compound Name | 9,12-bis(2-hydroxyethoxy)-3,6-dimethyldodeca-4,10-diyne-3,6-diol |
|---|---|
| PubChem CID | 129205019 |
| Molecular Formula | C18H30O6 |
| Molecular Weight | 342.43 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | 9,12-bis(2-hydroxyethoxy)-3,6-dimethyldodeca-4,10-diyne-3,6-diol |
| SMILES | CCC(C)(O)C#CC(C)(O)CCC(C#CCOCCO)OCCO |
| InChI | InChI=1S/C18H30O6/c1-4-17(2,21)9-10-18(3,22)8-7-16(24-15-12-20)6-5-13-23-14-11-19/h16,19-22H,4,7-8,11-15H2,1-3H3 |
| InChIKey | MWURIBKJPZUEOB-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.43 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|