About 5-oxatetracyclo[7.2.1.04,11.06,10]dodeca-2,7-diene
5-oxatetracyclo[7.2.1.04,11.06,10]dodeca-2,7-diene (PubChem CID 12920503) has the molecular formula C11H12O
and a molecular weight of 160.22 g/mol. Its IUPAC name is 5-oxatetracyclo[7.2.1.04,11.06,10]dodeca-2,7-diene.
Molecular Properties
| Compound Name | 5-oxatetracyclo[7.2.1.04,11.06,10]dodeca-2,7-diene |
| PubChem CID | 12920503 |
| Molecular Formula | C11H12O |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.09 |
| IUPAC Name | 5-oxatetracyclo[7.2.1.04,11.06,10]dodeca-2,7-diene |
| SMILES | C1=CC2OC3C=CC4CC1C2C43 |
| InChI | InChI=1S/C11H12O/c1-3-8-10-6(1)5-7-2-4-9(12-8)11(7)10/h1-4,6-11H,5H2 |
| InChIKey | SQDSTNKGJKMICP-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-oxatetracyclo[7.2.1.04,11.06,10]dodeca-2,7-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-oxatetracyclo[7.2.1.04,11.06,10]dodeca-2,7-diene?
The IUPAC name of 5-oxatetracyclo[7.2.1.04,11.06,10]dodeca-2,7-diene (CID 12920503) is 5-oxatetracyclo[7.2.1.04,11.06,10]dodeca-2,7-diene.
What is the SMILES notation for 5-oxatetracyclo[7.2.1.04,11.06,10]dodeca-2,7-diene?
The canonical SMILES for 5-oxatetracyclo[7.2.1.04,11.06,10]dodeca-2,7-diene is C1=CC2OC3C=CC4CC1C2C43.
What is the InChIKey of 5-oxatetracyclo[7.2.1.04,11.06,10]dodeca-2,7-diene?
The InChIKey is SQDSTNKGJKMICP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O/c1-3-8-10-6(1)5-7-2-4-9(12-8)11(7)10/h1-4,6-11H,5H2.
What are the key properties of 5-oxatetracyclo[7.2.1.04,11.06,10]dodeca-2,7-diene?
5-oxatetracyclo[7.2.1.04,11.06,10]dodeca-2,7-diene has a molecular weight of 160.22 g/mol, XLogP of 1.76, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-oxatetracyclo[7.2.1.04,11.06,10]dodeca-2,7-diene is sourced from PubChem (CID 12920503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).