C25H21F6N3O5S — CID 129205093
2-acetyl-5-[(1-cyanocyclopropyl)methylsulfonyl]-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1,3-dihydroisoindole-1-carboxamide (PubChem CID 129205093) has the molecular formula C25H21F6N3O5S and a molecular weight of 589.51 g/mol. Its IUPAC name is 2-acetyl-5-[(1-cyanocyclopropyl)methylsulfonyl]-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1,3-dihydroisoindole-1-carboxamide.
| Compound Name | 2-acetyl-5-[(1-cyanocyclopropyl)methylsulfonyl]-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1,3-dihydroisoindole-1-carboxamide |
|---|---|
| PubChem CID | 129205093 |
| Molecular Formula | C25H21F6N3O5S |
| Molecular Weight | 589.51 g/mol |
| Exact Mass | 589.11 |
| IUPAC Name | 2-acetyl-5-[(1-cyanocyclopropyl)methylsulfonyl]-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1,3-dihydroisoindole-1-carboxamide |
| SMILES | CC(=O)N1Cc2cc(S(=O)(=O)CC3(C#N)CC3)ccc2C1C(=O)Nc1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H21F6N3O5S/c1-14(35)34-11-15-10-18(40(38,39)13-22(12-32)8-9-22)6-7-19(15)20(34)21(36)33-17-4-2-16(3-5-17)23(37,24(26,27)28)25(29,30)31/h2-7,10,20,37H,8-9,11,13H2,1H3,(H,33,36) |
| InChIKey | QBKPVUOATLEJDS-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 127.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.51 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |