C22H20F6N2O5S — CID 129205095
2-acetyl-5-ethylsulfonyl-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1,3-dihydroisoindole-1-carboxamide (PubChem CID 129205095) has the molecular formula C22H20F6N2O5S and a molecular weight of 538.47 g/mol. Its IUPAC name is 2-acetyl-5-ethylsulfonyl-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1,3-dihydroisoindole-1-carboxamide.
| Compound Name | 2-acetyl-5-ethylsulfonyl-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1,3-dihydroisoindole-1-carboxamide |
|---|---|
| PubChem CID | 129205095 |
| Molecular Formula | C22H20F6N2O5S |
| Molecular Weight | 538.47 g/mol |
| Exact Mass | 538.10 |
| IUPAC Name | 2-acetyl-5-ethylsulfonyl-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1,3-dihydroisoindole-1-carboxamide |
| SMILES | CCS(=O)(=O)c1ccc2c(c1)CN(C(C)=O)C2C(=O)Nc1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H20F6N2O5S/c1-3-36(34,35)16-8-9-17-13(10-16)11-30(12(2)31)18(17)19(32)29-15-6-4-14(5-7-15)20(33,21(23,24)25)22(26,27)28/h4-10,18,33H,3,11H2,1-2H3,(H,29,32) |
| InChIKey | WUZNZQZEJJUMBN-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.47 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |