About N'-[(Z)-[amino-(2,6-dibromophenyl)methylidene]amino]-2-bromo-6-chlorobenzenecarboximidamide
N'-[(Z)-[amino-(2,6-dibromophenyl)methylidene]amino]-2-bromo-6-chlorobenzenecarboximidamide (PubChem CID 129205121) has the molecular formula C14H10Br3ClN4
and a molecular weight of 509.43 g/mol. Its IUPAC name is N'-[(Z)-[amino-(2,6-dibromophenyl)methylidene]amino]-2-bromo-6-chlorobenzenecarboximidamide.
Molecular Properties
| Compound Name | N'-[(Z)-[amino-(2,6-dibromophenyl)methylidene]amino]-2-bromo-6-chlorobenzenecarboximidamide |
| PubChem CID | 129205121 |
| Molecular Formula | C14H10Br3ClN4 |
| Molecular Weight | 509.43 g/mol |
| Exact Mass | 505.81 |
| IUPAC Name | N'-[(Z)-[amino-(2,6-dibromophenyl)methylidene]amino]-2-bromo-6-chlorobenzenecarboximidamide |
| SMILES | N/C(=N\N=C(/N)c1c(Br)cccc1Br)c1c(Cl)cccc1Br |
| InChI | InChI=1S/C14H10Br3ClN4/c15-7-3-1-4-8(16)11(7)13(19)21-22-14(20)12-9(17)5-2-6-10(12)18/h1-6H,(H2,19,21)(H2,20,22) |
| InChIKey | QKPRXGWZSBIOMU-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 509.43 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-[(Z)-[amino-(2,6-dibromophenyl)methylidene]amino]-2-bromo-6-chlorobenzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(Z)-[amino-(2,6-dibromophenyl)methylidene]amino]-2-bromo-6-chlorobenzenecarboximidamide?
The IUPAC name of N'-[(Z)-[amino-(2,6-dibromophenyl)methylidene]amino]-2-bromo-6-chlorobenzenecarboximidamide (CID 129205121) is N'-[(Z)-[amino-(2,6-dibromophenyl)methylidene]amino]-2-bromo-6-chlorobenzenecarboximidamide.
What is the SMILES notation for N'-[(Z)-[amino-(2,6-dibromophenyl)methylidene]amino]-2-bromo-6-chlorobenzenecarboximidamide?
The canonical SMILES for N'-[(Z)-[amino-(2,6-dibromophenyl)methylidene]amino]-2-bromo-6-chlorobenzenecarboximidamide is N/C(=N\N=C(/N)c1c(Br)cccc1Br)c1c(Cl)cccc1Br.
What is the InChIKey of N'-[(Z)-[amino-(2,6-dibromophenyl)methylidene]amino]-2-bromo-6-chlorobenzenecarboximidamide?
The InChIKey is QKPRXGWZSBIOMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10Br3ClN4/c15-7-3-1-4-8(16)11(7)13(19)21-22-14(20)12-9(17)5-2-6-10(12)18/h1-6H,(H2,19,21)(H2,20,22).
What are the key properties of N'-[(Z)-[amino-(2,6-dibromophenyl)methylidene]amino]-2-bromo-6-chlorobenzenecarboximidamide?
N'-[(Z)-[amino-(2,6-dibromophenyl)methylidene]amino]-2-bromo-6-chlorobenzenecarboximidamide has a molecular weight of 509.43 g/mol, XLogP of 4.65, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(Z)-[amino-(2,6-dibromophenyl)methylidene]amino]-2-bromo-6-chlorobenzenecarboximidamide is sourced from PubChem (CID 129205121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).