C21H18F6N2O5S — CID 129205142
5-ethylsulfonyl-2-formyl-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1,3-dihydroisoindole-1-carboxamide (PubChem CID 129205142) has the molecular formula C21H18F6N2O5S and a molecular weight of 524.44 g/mol. Its IUPAC name is 5-ethylsulfonyl-2-formyl-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1,3-dihydroisoindole-1-carboxamide.
| Compound Name | 5-ethylsulfonyl-2-formyl-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1,3-dihydroisoindole-1-carboxamide |
|---|---|
| PubChem CID | 129205142 |
| Molecular Formula | C21H18F6N2O5S |
| Molecular Weight | 524.44 g/mol |
| Exact Mass | 524.08 |
| IUPAC Name | 5-ethylsulfonyl-2-formyl-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1,3-dihydroisoindole-1-carboxamide |
| SMILES | CCS(=O)(=O)c1ccc2c(c1)CN(C=O)C2C(=O)Nc1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H18F6N2O5S/c1-2-35(33,34)15-7-8-16-12(9-15)10-29(11-30)17(16)18(31)28-14-5-3-13(4-6-14)19(32,20(22,23)24)21(25,26)27/h3-9,11,17,32H,2,10H2,1H3,(H,28,31) |
| InChIKey | FYIJFWZBSFEMNI-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.44 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|