C23H20F6N2O6S — CID 129205159
N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-5-methylsulfonyl-2-(oxetane-2-carbonyl)-1,3-dihydroisoindole-1-carboxamide (PubChem CID 129205159) has the molecular formula C23H20F6N2O6S and a molecular weight of 566.48 g/mol. Its IUPAC name is N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-5-methylsulfonyl-2-(oxetane-2-carbonyl)-1,3-dihydroisoindole-1-carboxamide.
| Compound Name | N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-5-methylsulfonyl-2-(oxetane-2-carbonyl)-1,3-dihydroisoindole-1-carboxamide |
|---|---|
| PubChem CID | 129205159 |
| Molecular Formula | C23H20F6N2O6S |
| Molecular Weight | 566.48 g/mol |
| Exact Mass | 566.09 |
| IUPAC Name | N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-5-methylsulfonyl-2-(oxetane-2-carbonyl)-1,3-dihydroisoindole-1-carboxamide |
| SMILES | CS(=O)(=O)c1ccc2c(c1)CN(C(=O)C1CCO1)C2C(=O)Nc1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H20F6N2O6S/c1-38(35,36)15-6-7-16-12(10-15)11-31(20(33)17-8-9-37-17)18(16)19(32)30-14-4-2-13(3-5-14)21(34,22(24,25)26)23(27,28)29/h2-7,10,17-18,34H,8-9,11H2,1H3,(H,30,32) |
| InChIKey | OAMVXQJATLBRNV-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.48 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |