C23H22F6N2O6S — CID 129205164
2-acetyl-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-5-(2-methoxyethylsulfonyl)-1,3-dihydroisoindole-1-carboxamide (PubChem CID 129205164) has the molecular formula C23H22F6N2O6S and a molecular weight of 568.49 g/mol. Its IUPAC name is 2-acetyl-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-5-(2-methoxyethylsulfonyl)-1,3-dihydroisoindole-1-carboxamide.
| Compound Name | 2-acetyl-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-5-(2-methoxyethylsulfonyl)-1,3-dihydroisoindole-1-carboxamide |
|---|---|
| PubChem CID | 129205164 |
| Molecular Formula | C23H22F6N2O6S |
| Molecular Weight | 568.49 g/mol |
| Exact Mass | 568.11 |
| IUPAC Name | 2-acetyl-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-5-(2-methoxyethylsulfonyl)-1,3-dihydroisoindole-1-carboxamide |
| SMILES | COCCS(=O)(=O)c1ccc2c(c1)CN(C(C)=O)C2C(=O)Nc1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H22F6N2O6S/c1-13(32)31-12-14-11-17(38(35,36)10-9-37-2)7-8-18(14)19(31)20(33)30-16-5-3-15(4-6-16)21(34,22(24,25)26)23(27,28)29/h3-8,11,19,34H,9-10,12H2,1-2H3,(H,30,33) |
| InChIKey | KNYPZXXDHPTCII-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.49 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |