C23H21F6N3O5S — CID 129205172
2-acetyl-5-(cyclopropylsulfamoyl)-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1,3-dihydroisoindole-1-carboxamide (PubChem CID 129205172) has the molecular formula C23H21F6N3O5S and a molecular weight of 565.49 g/mol. Its IUPAC name is 2-acetyl-5-(cyclopropylsulfamoyl)-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1,3-dihydroisoindole-1-carboxamide.
| Compound Name | 2-acetyl-5-(cyclopropylsulfamoyl)-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1,3-dihydroisoindole-1-carboxamide |
|---|---|
| PubChem CID | 129205172 |
| Molecular Formula | C23H21F6N3O5S |
| Molecular Weight | 565.49 g/mol |
| Exact Mass | 565.11 |
| IUPAC Name | 2-acetyl-5-(cyclopropylsulfamoyl)-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1,3-dihydroisoindole-1-carboxamide |
| SMILES | CC(=O)N1Cc2cc(S(=O)(=O)NC3CC3)ccc2C1C(=O)Nc1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H21F6N3O5S/c1-12(33)32-11-13-10-17(38(36,37)31-16-6-7-16)8-9-18(13)19(32)20(34)30-15-4-2-14(3-5-15)21(35,22(24,25)26)23(27,28)29/h2-5,8-10,16,19,31,35H,6-7,11H2,1H3,(H,30,34) |
| InChIKey | MGOPCYIZHYONRL-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.49 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |