C21H19F6N3O5S — CID 129205182
1-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2-N-methyl-5-methylsulfonyl-1,3-dihydroisoindole-1,2-dicarboxamide (PubChem CID 129205182) has the molecular formula C21H19F6N3O5S and a molecular weight of 539.45 g/mol. Its IUPAC name is 1-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2-N-methyl-5-methylsulfonyl-1,3-dihydroisoindole-1,2-dicarboxamide.
| Compound Name | 1-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2-N-methyl-5-methylsulfonyl-1,3-dihydroisoindole-1,2-dicarboxamide |
|---|---|
| PubChem CID | 129205182 |
| Molecular Formula | C21H19F6N3O5S |
| Molecular Weight | 539.45 g/mol |
| Exact Mass | 539.09 |
| IUPAC Name | 1-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2-N-methyl-5-methylsulfonyl-1,3-dihydroisoindole-1,2-dicarboxamide |
| SMILES | CNC(=O)N1Cc2cc(S(C)(=O)=O)ccc2C1C(=O)Nc1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H19F6N3O5S/c1-28-18(32)30-10-11-9-14(36(2,34)35)7-8-15(11)16(30)17(31)29-13-5-3-12(4-6-13)19(33,20(22,23)24)21(25,26)27/h3-9,16,33H,10H2,1-2H3,(H,28,32)(H,29,31) |
| InChIKey | KITJFQIVUFPUPD-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.45 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |