C19H30O5 — CID 129205541
[5-butanoyl-6-oxo-2-(2,3,3-trimethylbutan-2-yl)-2,3-dihydropyran-4-yl] propanoate (PubChem CID 129205541) has the molecular formula C19H30O5 and a molecular weight of 338.44 g/mol. Its IUPAC name is [5-butanoyl-6-oxo-2-(2,3,3-trimethylbutan-2-yl)-2,3-dihydropyran-4-yl] propanoate.
| Compound Name | [5-butanoyl-6-oxo-2-(2,3,3-trimethylbutan-2-yl)-2,3-dihydropyran-4-yl] propanoate |
|---|---|
| PubChem CID | 129205541 |
| Molecular Formula | C19H30O5 |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | [5-butanoyl-6-oxo-2-(2,3,3-trimethylbutan-2-yl)-2,3-dihydropyran-4-yl] propanoate |
| SMILES | CCCC(=O)C1=C(OC(=O)CC)CC(C(C)(C)C(C)(C)C)OC1=O |
| InChI | InChI=1S/C19H30O5/c1-8-10-12(20)16-13(23-15(21)9-2)11-14(24-17(16)22)19(6,7)18(3,4)5/h14H,8-11H2,1-7H3 |
| InChIKey | KFKOTONIWSFGKA-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|