About 3-phenylsulfanylbutanal
3-phenylsulfanylbutanal (PubChem CID 12920563) has the molecular formula C10H12OS
and a molecular weight of 180.27 g/mol. Its IUPAC name is 3-phenylsulfanylbutanal.
Molecular Properties
| Compound Name | 3-phenylsulfanylbutanal |
| PubChem CID | 12920563 |
| Molecular Formula | C10H12OS |
| Molecular Weight | 180.27 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | 3-phenylsulfanylbutanal |
| SMILES | CC(CC=O)Sc1ccccc1 |
| InChI | InChI=1S/C10H12OS/c1-9(7-8-11)12-10-5-3-2-4-6-10/h2-6,8-9H,7H2,1H3 |
| InChIKey | ZATQOYXJRKGDQE-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.27 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-phenylsulfanylbutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylsulfanylbutanal?
The IUPAC name of 3-phenylsulfanylbutanal (CID 12920563) is 3-phenylsulfanylbutanal.
What is the SMILES notation for 3-phenylsulfanylbutanal?
The canonical SMILES for 3-phenylsulfanylbutanal is CC(CC=O)Sc1ccccc1.
What is the InChIKey of 3-phenylsulfanylbutanal?
The InChIKey is ZATQOYXJRKGDQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12OS/c1-9(7-8-11)12-10-5-3-2-4-6-10/h2-6,8-9H,7H2,1H3.
What are the key properties of 3-phenylsulfanylbutanal?
3-phenylsulfanylbutanal has a molecular weight of 180.27 g/mol, XLogP of 2.76, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylsulfanylbutanal is sourced from PubChem (CID 12920563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).