C20H29N3O4 — CID 129205937
2-tert-butyl-1-(4-methoxyphenyl)-2-methyl-4-oxo-1,3,8-triazaspiro[4.5]decane-8-carboxylic acid (PubChem CID 129205937) has the molecular formula C20H29N3O4 and a molecular weight of 375.47 g/mol. Its IUPAC name is 2-tert-butyl-1-(4-methoxyphenyl)-2-methyl-4-oxo-1,3,8-triazaspiro[4.5]decane-8-carboxylic acid.
| Compound Name | 2-tert-butyl-1-(4-methoxyphenyl)-2-methyl-4-oxo-1,3,8-triazaspiro[4.5]decane-8-carboxylic acid |
|---|---|
| PubChem CID | 129205937 |
| Molecular Formula | C20H29N3O4 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | 2-tert-butyl-1-(4-methoxyphenyl)-2-methyl-4-oxo-1,3,8-triazaspiro[4.5]decane-8-carboxylic acid |
| SMILES | COc1ccc(N2C3(CCN(C(=O)O)CC3)C(=O)NC2(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C20H29N3O4/c1-18(2,3)19(4)21-16(24)20(10-12-22(13-11-20)17(25)26)23(19)14-6-8-15(27-5)9-7-14/h6-9H,10-13H2,1-5H3,(H,21,24)(H,25,26) |
| InChIKey | AXSLPQBZJJEVST-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|