C36H6F8N8O2 — CID 129206080
(3E,7E)-3,7-bis[cyano-(3,5-dicyanophenyl)methylidene]-2,6-difluoro-4,8-bis(trifluoromethoxy)-s-indacene-1,5-dicarbonitrile (PubChem CID 129206080) has the molecular formula C36H6F8N8O2 and a molecular weight of 734.48 g/mol. Its IUPAC name is (3E,7E)-3,7-bis[cyano-(3,5-dicyanophenyl)methylidene]-2,6-difluoro-4,8-bis(trifluoromethoxy)-s-indacene-1,5-dicarbonitrile.
| Compound Name | (3E,7E)-3,7-bis[cyano-(3,5-dicyanophenyl)methylidene]-2,6-difluoro-4,8-bis(trifluoromethoxy)-s-indacene-1,5-dicarbonitrile |
|---|---|
| PubChem CID | 129206080 |
| Molecular Formula | C36H6F8N8O2 |
| Molecular Weight | 734.48 g/mol |
| Exact Mass | 734.05 |
| IUPAC Name | (3E,7E)-3,7-bis[cyano-(3,5-dicyanophenyl)methylidene]-2,6-difluoro-4,8-bis(trifluoromethoxy)-s-indacene-1,5-dicarbonitrile |
| SMILES | N#CC1=C(F)/C(=C(/C#N)c2cc(C#N)cc(C#N)c2)c2c(OC(F)(F)F)c3c(c(OC(F)(F)F)c21)/C(=C(\C#N)c1cc(C#N)cc(C#N)c1)C(F)=C3C#N |
| InChI | InChI=1S/C36H6F8N8O2/c37-31-23(13-51)27-29(25(31)21(11-49)19-3-15(7-45)1-16(4-19)8-46)33(53-35(39,40)41)28-24(14-52)32(38)26(30(28)34(27)54-36(42,43)44)22(12-50)20-5-17(9-47)2-18(6-20)10-48/h1-6H/b25-21-,26-22- |
| InChIKey | OKDOGUFDBOTPLC-ORFRIDJFSA-N |
| XLogP | 8.27 |
| TPSA | 208.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.48 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|