C23HF6N7O2 — CID 129206091
(3Z)-3-(cyanomethylidene)-5-(dicyanomethylidene)-4,8-bis(trifluoromethoxy)-s-indacene-1,2,6,7-tetracarbonitrile (PubChem CID 129206091) has the molecular formula C23HF6N7O2 and a molecular weight of 521.30 g/mol. Its IUPAC name is (3Z)-3-(cyanomethylidene)-5-(dicyanomethylidene)-4,8-bis(trifluoromethoxy)-s-indacene-1,2,6,7-tetracarbonitrile.
| Compound Name | (3Z)-3-(cyanomethylidene)-5-(dicyanomethylidene)-4,8-bis(trifluoromethoxy)-s-indacene-1,2,6,7-tetracarbonitrile |
|---|---|
| PubChem CID | 129206091 |
| Molecular Formula | C23HF6N7O2 |
| Molecular Weight | 521.30 g/mol |
| Exact Mass | 521.01 |
| IUPAC Name | (3Z)-3-(cyanomethylidene)-5-(dicyanomethylidene)-4,8-bis(trifluoromethoxy)-s-indacene-1,2,6,7-tetracarbonitrile |
| SMILES | N#C/C=C1/C(C#N)=C(C#N)c2c(OC(F)(F)F)c3c(c(OC(F)(F)F)c21)C(=C(C#N)C#N)C(C#N)=C3C#N |
| InChI | InChI=1S/C23HF6N7O2/c24-22(25,26)37-20-17-12(6-34)11(5-33)10(1-2-30)16(17)21(38-23(27,28)29)19-15(9(3-31)4-32)13(7-35)14(8-36)18(19)20/h1H/b10-1- |
| InChIKey | NKBDUAJGHKPUHM-LAFDYMOFSA-N |
| XLogP | 4.82 |
| TPSA | 184.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.30 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|