C23H3F6N7O2 — CID 129206096
(5Z)-5-(cyanomethylidene)-3-(dicyanomethyl)-4,8-bis(trifluoromethoxy)-3H-s-indacene-1,2,6,7-tetracarbonitrile (PubChem CID 129206096) has the molecular formula C23H3F6N7O2 and a molecular weight of 523.31 g/mol. Its IUPAC name is (5Z)-5-(cyanomethylidene)-3-(dicyanomethyl)-4,8-bis(trifluoromethoxy)-3H-s-indacene-1,2,6,7-tetracarbonitrile.
| Compound Name | (5Z)-5-(cyanomethylidene)-3-(dicyanomethyl)-4,8-bis(trifluoromethoxy)-3H-s-indacene-1,2,6,7-tetracarbonitrile |
|---|---|
| PubChem CID | 129206096 |
| Molecular Formula | C23H3F6N7O2 |
| Molecular Weight | 523.31 g/mol |
| Exact Mass | 523.03 |
| IUPAC Name | (5Z)-5-(cyanomethylidene)-3-(dicyanomethyl)-4,8-bis(trifluoromethoxy)-3H-s-indacene-1,2,6,7-tetracarbonitrile |
| SMILES | N#C/C=C1/C(C#N)=C(C#N)c2c(OC(F)(F)F)c3c(c(OC(F)(F)F)c21)C(C(C#N)C#N)C(C#N)=C3C#N |
| InChI | InChI=1S/C23H3F6N7O2/c24-22(25,26)37-20-17-12(6-34)11(5-33)10(1-2-30)16(17)21(38-23(27,28)29)19-15(9(3-31)4-32)13(7-35)14(8-36)18(19)20/h1,9,15H/b10-1- |
| InChIKey | IXZNBKGBIKCRJP-LAFDYMOFSA-N |
| XLogP | 4.77 |
| TPSA | 184.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.31 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|