C34H10F6N6 — CID 129206111
3,7-bis(dicyanomethylidene)-2,6-bis[4-(trifluoromethyl)phenyl]-s-indacene-1,5-dicarbonitrile (PubChem CID 129206111) has the molecular formula C34H10F6N6 and a molecular weight of 616.48 g/mol. Its IUPAC name is 3,7-bis(dicyanomethylidene)-2,6-bis[4-(trifluoromethyl)phenyl]-s-indacene-1,5-dicarbonitrile.
| Compound Name | 3,7-bis(dicyanomethylidene)-2,6-bis[4-(trifluoromethyl)phenyl]-s-indacene-1,5-dicarbonitrile |
|---|---|
| PubChem CID | 129206111 |
| Molecular Formula | C34H10F6N6 |
| Molecular Weight | 616.48 g/mol |
| Exact Mass | 616.09 |
| IUPAC Name | 3,7-bis(dicyanomethylidene)-2,6-bis[4-(trifluoromethyl)phenyl]-s-indacene-1,5-dicarbonitrile |
| SMILES | N#CC(C#N)=C1C(c2ccc(C(F)(F)F)cc2)=C(C#N)c2cc3c(cc21)C(C#N)=C(c1ccc(C(F)(F)F)cc1)C3=C(C#N)C#N |
| InChI | InChI=1S/C34H10F6N6/c35-33(36,37)21-5-1-17(2-6-21)29-27(15-45)23-9-26-24(10-25(23)31(29)19(11-41)12-42)28(16-46)30(32(26)20(13-43)14-44)18-3-7-22(8-4-18)34(38,39)40/h1-10H |
| InChIKey | DURYNXRHOHQYRB-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 142.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.48 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|