C20H22Cl2N2O4 — CID 129206716
N-[(2R,3S)-4-benzamido-2-ethoxy-3-hydroxybutyl]-2,4-dichlorobenzamide (PubChem CID 129206716) has the molecular formula C20H22Cl2N2O4 and a molecular weight of 425.31 g/mol. Its IUPAC name is N-[(2R,3S)-4-benzamido-2-ethoxy-3-hydroxybutyl]-2,4-dichlorobenzamide.
| Compound Name | N-[(2R,3S)-4-benzamido-2-ethoxy-3-hydroxybutyl]-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 129206716 |
| Molecular Formula | C20H22Cl2N2O4 |
| Molecular Weight | 425.31 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | N-[(2R,3S)-4-benzamido-2-ethoxy-3-hydroxybutyl]-2,4-dichlorobenzamide |
| SMILES | CCO[C@H](CNC(=O)c1ccc(Cl)cc1Cl)[C@@H](O)CNC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H22Cl2N2O4/c1-2-28-18(12-24-20(27)15-9-8-14(21)10-16(15)22)17(25)11-23-19(26)13-6-4-3-5-7-13/h3-10,17-18,25H,2,11-12H2,1H3,(H,23,26)(H,24,27)/t17-,18+/m0/s1 |
| InChIKey | JFSSOZPSNBPBFG-ZWKOTPCHSA-N |
| XLogP | 2.92 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.31 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |