C30H32N2O6 — CID 129207064
N-[[(3aR,4R,6aR)-3a-(benzamidomethyl)-2,2-dimethyl-4-phenylmethoxy-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-6-yl]methyl]benzamide (PubChem CID 129207064) has the molecular formula C30H32N2O6 and a molecular weight of 516.59 g/mol. Its IUPAC name is N-[[(3aR,4R,6aR)-3a-(benzamidomethyl)-2,2-dimethyl-4-phenylmethoxy-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-6-yl]methyl]benzamide.
| Compound Name | N-[[(3aR,4R,6aR)-3a-(benzamidomethyl)-2,2-dimethyl-4-phenylmethoxy-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-6-yl]methyl]benzamide |
|---|---|
| PubChem CID | 129207064 |
| Molecular Formula | C30H32N2O6 |
| Molecular Weight | 516.59 g/mol |
| Exact Mass | 516.23 |
| IUPAC Name | N-[[(3aR,4R,6aR)-3a-(benzamidomethyl)-2,2-dimethyl-4-phenylmethoxy-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-6-yl]methyl]benzamide |
| SMILES | CC1(C)O[C@@H]2C(CNC(=O)c3ccccc3)O[C@@H](OCc3ccccc3)[C@]2(CNC(=O)c2ccccc2)O1 |
| InChI | InChI=1S/C30H32N2O6/c1-29(2)37-25-24(18-31-26(33)22-14-8-4-9-15-22)36-28(35-19-21-12-6-3-7-13-21)30(25,38-29)20-32-27(34)23-16-10-5-11-17-23/h3-17,24-25,28H,18-20H2,1-2H3,(H,31,33)(H,32,34)/t24?,25-,28-,30-/m1/s1 |
| InChIKey | UIFHIRJTHVAUCW-GTNRJGJJSA-N |
| XLogP | 3.68 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.59 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |