C25H26ClF3N2O5 — CID 129207173
N-[[(3aS,6R,6aR)-6-[[[3-(2-chlorophenyl)oxiran-2-yl]amino]methyl]-2,2-dimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-3a-yl]methyl]-4-(trifluoromethyl)benzamide (PubChem CID 129207173) has the molecular formula C25H26ClF3N2O5 and a molecular weight of 526.94 g/mol. Its IUPAC name is N-[[(3aS,6R,6aR)-6-[[[3-(2-chlorophenyl)oxiran-2-yl]amino]methyl]-2,2-dimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-3a-yl]methyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[[(3aS,6R,6aR)-6-[[[3-(2-chlorophenyl)oxiran-2-yl]amino]methyl]-2,2-dimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-3a-yl]methyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 129207173 |
| Molecular Formula | C25H26ClF3N2O5 |
| Molecular Weight | 526.94 g/mol |
| Exact Mass | 526.15 |
| IUPAC Name | N-[[(3aS,6R,6aR)-6-[[[3-(2-chlorophenyl)oxiran-2-yl]amino]methyl]-2,2-dimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-3a-yl]methyl]-4-(trifluoromethyl)benzamide |
| SMILES | CC1(C)O[C@@H]2[C@@H](CNC3OC3c3ccccc3Cl)OC[C@]2(CNC(=O)c2ccc(C(F)(F)F)cc2)O1 |
| InChI | InChI=1S/C25H26ClF3N2O5/c1-23(2)35-20-18(11-30-22-19(34-22)16-5-3-4-6-17(16)26)33-13-24(20,36-23)12-31-21(32)14-7-9-15(10-8-14)25(27,28)29/h3-10,18-20,22,30H,11-13H2,1-2H3,(H,31,32)/t18-,19?,20-,22?,24+/m1/s1 |
| InChIKey | QTQNDIOWWOBSQV-SENYWLSFSA-N |
| XLogP | 4.06 |
| TPSA | 81.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.94 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|