C23H27ClN2O5 — CID 129207221
N-[[(3aS,6R,6aR)-6-[[[(3-chlorophenyl)-hydroxymethyl]amino]methyl]-2,2-dimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-3a-yl]methyl]benzamide (PubChem CID 129207221) has the molecular formula C23H27ClN2O5 and a molecular weight of 446.93 g/mol. Its IUPAC name is N-[[(3aS,6R,6aR)-6-[[[(3-chlorophenyl)-hydroxymethyl]amino]methyl]-2,2-dimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-3a-yl]methyl]benzamide.
| Compound Name | N-[[(3aS,6R,6aR)-6-[[[(3-chlorophenyl)-hydroxymethyl]amino]methyl]-2,2-dimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-3a-yl]methyl]benzamide |
|---|---|
| PubChem CID | 129207221 |
| Molecular Formula | C23H27ClN2O5 |
| Molecular Weight | 446.93 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | N-[[(3aS,6R,6aR)-6-[[[(3-chlorophenyl)-hydroxymethyl]amino]methyl]-2,2-dimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-3a-yl]methyl]benzamide |
| SMILES | CC1(C)O[C@@H]2[C@@H](CNC(O)c3cccc(Cl)c3)OC[C@]2(CNC(=O)c2ccccc2)O1 |
| InChI | InChI=1S/C23H27ClN2O5/c1-22(2)30-19-18(12-25-21(28)16-9-6-10-17(24)11-16)29-14-23(19,31-22)13-26-20(27)15-7-4-3-5-8-15/h3-11,18-19,21,25,28H,12-14H2,1-2H3,(H,26,27)/t18-,19-,21?,23+/m1/s1 |
| InChIKey | WCBRVACCYBTKJU-AWUSXSSMSA-N |
| XLogP | 2.64 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.93 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|