C10H11F8N — CID 129207499
1-(1,1,1,2,3-pentafluorobut-3-en-2-yl)-4-(trifluoromethyl)piperidine (PubChem CID 129207499) has the molecular formula C10H11F8N and a molecular weight of 297.19 g/mol. Its IUPAC name is 1-(1,1,1,2,3-pentafluorobut-3-en-2-yl)-4-(trifluoromethyl)piperidine.
| Compound Name | 1-(1,1,1,2,3-pentafluorobut-3-en-2-yl)-4-(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 129207499 |
| Molecular Formula | C10H11F8N |
| Molecular Weight | 297.19 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 1-(1,1,1,2,3-pentafluorobut-3-en-2-yl)-4-(trifluoromethyl)piperidine |
| SMILES | C=C(F)C(F)(N1CCC(C(F)(F)F)CC1)C(F)(F)F |
| InChI | InChI=1S/C10H11F8N/c1-6(11)8(12,10(16,17)18)19-4-2-7(3-5-19)9(13,14)15/h7H,1-5H2 |
| InChIKey | TYVWKTUBRQZGOK-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.19 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|