About 1-[1,1-difluoro-2-(trifluoromethyl)prop-2-enyl]-4-(trifluoromethyl)piperidine
1-[1,1-difluoro-2-(trifluoromethyl)prop-2-enyl]-4-(trifluoromethyl)piperidine (PubChem CID 129207501) has the molecular formula C10H11F8N
and a molecular weight of 297.19 g/mol. Its IUPAC name is 1-[1,1-difluoro-2-(trifluoromethyl)prop-2-enyl]-4-(trifluoromethyl)piperidine.
Molecular Properties
| Compound Name | 1-[1,1-difluoro-2-(trifluoromethyl)prop-2-enyl]-4-(trifluoromethyl)piperidine |
| PubChem CID | 129207501 |
| Molecular Formula | C10H11F8N |
| Molecular Weight | 297.19 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 1-[1,1-difluoro-2-(trifluoromethyl)prop-2-enyl]-4-(trifluoromethyl)piperidine |
| SMILES | C=C(C(F)(F)F)C(F)(F)N1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C10H11F8N/c1-6(8(11,12)13)10(17,18)19-4-2-7(3-5-19)9(14,15)16/h7H,1-5H2 |
| InChIKey | BDGYRWIUHZWJGV-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.19 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-[1,1-difluoro-2-(trifluoromethyl)prop-2-enyl]-4-(trifluoromethyl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1,1-difluoro-2-(trifluoromethyl)prop-2-enyl]-4-(trifluoromethyl)piperidine?
The IUPAC name of 1-[1,1-difluoro-2-(trifluoromethyl)prop-2-enyl]-4-(trifluoromethyl)piperidine (CID 129207501) is 1-[1,1-difluoro-2-(trifluoromethyl)prop-2-enyl]-4-(trifluoromethyl)piperidine.
What is the SMILES notation for 1-[1,1-difluoro-2-(trifluoromethyl)prop-2-enyl]-4-(trifluoromethyl)piperidine?
The canonical SMILES for 1-[1,1-difluoro-2-(trifluoromethyl)prop-2-enyl]-4-(trifluoromethyl)piperidine is C=C(C(F)(F)F)C(F)(F)N1CCC(C(F)(F)F)CC1.
What is the InChIKey of 1-[1,1-difluoro-2-(trifluoromethyl)prop-2-enyl]-4-(trifluoromethyl)piperidine?
The InChIKey is BDGYRWIUHZWJGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F8N/c1-6(8(11,12)13)10(17,18)19-4-2-7(3-5-19)9(14,15)16/h7H,1-5H2.
What are the key properties of 1-[1,1-difluoro-2-(trifluoromethyl)prop-2-enyl]-4-(trifluoromethyl)piperidine?
1-[1,1-difluoro-2-(trifluoromethyl)prop-2-enyl]-4-(trifluoromethyl)piperidine has a molecular weight of 297.19 g/mol, XLogP of 3.97, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1,1-difluoro-2-(trifluoromethyl)prop-2-enyl]-4-(trifluoromethyl)piperidine is sourced from PubChem (CID 129207501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).