C9H13F5N2 — CID 129207513
1-methyl-4-(1,1,1,2,3-pentafluorobut-3-en-2-yl)piperazine (PubChem CID 129207513) has the molecular formula C9H13F5N2 and a molecular weight of 244.21 g/mol. Its IUPAC name is 1-methyl-4-(1,1,1,2,3-pentafluorobut-3-en-2-yl)piperazine.
| Compound Name | 1-methyl-4-(1,1,1,2,3-pentafluorobut-3-en-2-yl)piperazine |
|---|---|
| PubChem CID | 129207513 |
| Molecular Formula | C9H13F5N2 |
| Molecular Weight | 244.21 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 1-methyl-4-(1,1,1,2,3-pentafluorobut-3-en-2-yl)piperazine |
| SMILES | C=C(F)C(F)(N1CCN(C)CC1)C(F)(F)F |
| InChI | InChI=1S/C9H13F5N2/c1-7(10)8(11,9(12,13)14)16-5-3-15(2)4-6-16/h1,3-6H2,2H3 |
| InChIKey | VLRYOAPHJTVDKT-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.21 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|