About 1,1-difluoro-N,N-dimethyl-2-(trifluoromethyl)prop-2-en-1-amine
1,1-difluoro-N,N-dimethyl-2-(trifluoromethyl)prop-2-en-1-amine (PubChem CID 129207515) has the molecular formula C6H8F5N
and a molecular weight of 189.13 g/mol. Its IUPAC name is 1,1-difluoro-N,N-dimethyl-2-(trifluoromethyl)prop-2-en-1-amine.
Molecular Properties
| Compound Name | 1,1-difluoro-N,N-dimethyl-2-(trifluoromethyl)prop-2-en-1-amine |
| PubChem CID | 129207515 |
| Molecular Formula | C6H8F5N |
| Molecular Weight | 189.13 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | 1,1-difluoro-N,N-dimethyl-2-(trifluoromethyl)prop-2-en-1-amine |
| SMILES | C=C(C(F)(F)F)C(F)(F)N(C)C |
| InChI | InChI=1S/C6H8F5N/c1-4(5(7,8)9)6(10,11)12(2)3/h1H2,2-3H3 |
| InChIKey | LJSGDBFFHYZCJM-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.13 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1,1-difluoro-N,N-dimethyl-2-(trifluoromethyl)prop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-difluoro-N,N-dimethyl-2-(trifluoromethyl)prop-2-en-1-amine?
The IUPAC name of 1,1-difluoro-N,N-dimethyl-2-(trifluoromethyl)prop-2-en-1-amine (CID 129207515) is 1,1-difluoro-N,N-dimethyl-2-(trifluoromethyl)prop-2-en-1-amine.
What is the SMILES notation for 1,1-difluoro-N,N-dimethyl-2-(trifluoromethyl)prop-2-en-1-amine?
The canonical SMILES for 1,1-difluoro-N,N-dimethyl-2-(trifluoromethyl)prop-2-en-1-amine is C=C(C(F)(F)F)C(F)(F)N(C)C.
What is the InChIKey of 1,1-difluoro-N,N-dimethyl-2-(trifluoromethyl)prop-2-en-1-amine?
The InChIKey is LJSGDBFFHYZCJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8F5N/c1-4(5(7,8)9)6(10,11)12(2)3/h1H2,2-3H3.
What are the key properties of 1,1-difluoro-N,N-dimethyl-2-(trifluoromethyl)prop-2-en-1-amine?
1,1-difluoro-N,N-dimethyl-2-(trifluoromethyl)prop-2-en-1-amine has a molecular weight of 189.13 g/mol, XLogP of 2.26, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-difluoro-N,N-dimethyl-2-(trifluoromethyl)prop-2-en-1-amine is sourced from PubChem (CID 129207515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).