C11H12F9N — CID 129207969
1-(1,1,1-trifluorobut-3-en-2-yl)-3,5-bis(trifluoromethyl)piperidine (PubChem CID 129207969) has the molecular formula C11H12F9N and a molecular weight of 329.21 g/mol. Its IUPAC name is 1-(1,1,1-trifluorobut-3-en-2-yl)-3,5-bis(trifluoromethyl)piperidine.
| Compound Name | 1-(1,1,1-trifluorobut-3-en-2-yl)-3,5-bis(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 129207969 |
| Molecular Formula | C11H12F9N |
| Molecular Weight | 329.21 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 1-(1,1,1-trifluorobut-3-en-2-yl)-3,5-bis(trifluoromethyl)piperidine |
| SMILES | C=CC(N1CC(C(F)(F)F)CC(C(F)(F)F)C1)C(F)(F)F |
| InChI | InChI=1S/C11H12F9N/c1-2-8(11(18,19)20)21-4-6(9(12,13)14)3-7(5-21)10(15,16)17/h2,6-8H,1,3-5H2 |
| InChIKey | KQPOHQCOJXTVFC-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.21 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|