C9H9F8NO — CID 129208030
2,2,3,3-tetrafluoro-3-[4-(trifluoromethyl)piperidin-1-yl]propanoyl fluoride (PubChem CID 129208030) has the molecular formula C9H9F8NO and a molecular weight of 299.16 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-3-[4-(trifluoromethyl)piperidin-1-yl]propanoyl fluoride.
| Compound Name | 2,2,3,3-tetrafluoro-3-[4-(trifluoromethyl)piperidin-1-yl]propanoyl fluoride |
|---|---|
| PubChem CID | 129208030 |
| Molecular Formula | C9H9F8NO |
| Molecular Weight | 299.16 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 2,2,3,3-tetrafluoro-3-[4-(trifluoromethyl)piperidin-1-yl]propanoyl fluoride |
| SMILES | O=C(F)C(F)(F)C(F)(F)N1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C9H9F8NO/c10-6(19)7(11,12)9(16,17)18-3-1-5(2-4-18)8(13,14)15/h5H,1-4H2 |
| InChIKey | MZVFQXMBKBNICZ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.16 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|