C31H49N3O5S — CID 129208145
[1-[4-[[(7E)-7-ethyl-2-hydroxy-3-methyldeca-1,7,9-trien-5-yl]carbamoyl]-1,3-thiazol-2-yl]-4-methyl-3-[methyl(pentanoyl)amino]pentyl] acetate (PubChem CID 129208145) has the molecular formula C31H49N3O5S and a molecular weight of 575.82 g/mol. Its IUPAC name is [1-[4-[[(7E)-7-ethyl-2-hydroxy-3-methyldeca-1,7,9-trien-5-yl]carbamoyl]-1,3-thiazol-2-yl]-4-methyl-3-[methyl(pentanoyl)amino]pentyl] acetate.
| Compound Name | [1-[4-[[(7E)-7-ethyl-2-hydroxy-3-methyldeca-1,7,9-trien-5-yl]carbamoyl]-1,3-thiazol-2-yl]-4-methyl-3-[methyl(pentanoyl)amino]pentyl] acetate |
|---|---|
| PubChem CID | 129208145 |
| Molecular Formula | C31H49N3O5S |
| Molecular Weight | 575.82 g/mol |
| Exact Mass | 575.34 |
| IUPAC Name | [1-[4-[[(7E)-7-ethyl-2-hydroxy-3-methyldeca-1,7,9-trien-5-yl]carbamoyl]-1,3-thiazol-2-yl]-4-methyl-3-[methyl(pentanoyl)amino]pentyl] acetate |
| SMILES | C=C/C=C(\CC)CC(CC(C)C(=C)O)NC(=O)c1csc(C(CC(C(C)C)N(C)C(=O)CCCC)OC(C)=O)n1 |
| InChI | InChI=1S/C31H49N3O5S/c1-10-13-15-29(37)34(9)27(20(4)5)18-28(39-23(8)36)31-33-26(19-40-31)30(38)32-25(16-21(6)22(7)35)17-24(12-3)14-11-2/h11,14,19-21,25,27-28,35H,2,7,10,12-13,15-18H2,1,3-6,8-9H3,(H,32,38)/b24-14+ |
| InChIKey | WPSKQMZCSYIFHB-ZVHZXABRSA-N |
| XLogP | 6.92 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.82 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|