C21H31F2NO3 — CID 129208272
7-[5-[(E)-3,4-dimethyloct-1-en-6-ynyl]-3,3-difluoro-2-oxopyrrolidin-1-yl]heptanoic acid (PubChem CID 129208272) has the molecular formula C21H31F2NO3 and a molecular weight of 383.48 g/mol. Its IUPAC name is 7-[5-[(E)-3,4-dimethyloct-1-en-6-ynyl]-3,3-difluoro-2-oxopyrrolidin-1-yl]heptanoic acid.
| Compound Name | 7-[5-[(E)-3,4-dimethyloct-1-en-6-ynyl]-3,3-difluoro-2-oxopyrrolidin-1-yl]heptanoic acid |
|---|---|
| PubChem CID | 129208272 |
| Molecular Formula | C21H31F2NO3 |
| Molecular Weight | 383.48 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | 7-[5-[(E)-3,4-dimethyloct-1-en-6-ynyl]-3,3-difluoro-2-oxopyrrolidin-1-yl]heptanoic acid |
| SMILES | CC#CCC(C)C(C)/C=C/C1CC(F)(F)C(=O)N1CCCCCCC(=O)O |
| InChI | InChI=1S/C21H31F2NO3/c1-4-5-10-16(2)17(3)12-13-18-15-21(22,23)20(27)24(18)14-9-7-6-8-11-19(25)26/h12-13,16-18H,6-11,14-15H2,1-3H3,(H,25,26)/b13-12+ |
| InChIKey | MEZQRESRUGYESR-OUKQBFOZSA-N |
| XLogP | 4.50 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.48 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|