About methyl 5-[(Z)-3-(3,3-difluoro-2-oxopyrrolidin-1-yl)prop-1-enyl]thiophene-2-carboxylate
methyl 5-[(Z)-3-(3,3-difluoro-2-oxopyrrolidin-1-yl)prop-1-enyl]thiophene-2-carboxylate (PubChem CID 129208365) has the molecular formula C13H13F2NO3S
and a molecular weight of 301.31 g/mol. Its IUPAC name is methyl 5-[(Z)-3-(3,3-difluoro-2-oxopyrrolidin-1-yl)prop-1-enyl]thiophene-2-carboxylate.
Molecular Properties
| Compound Name | methyl 5-[(Z)-3-(3,3-difluoro-2-oxopyrrolidin-1-yl)prop-1-enyl]thiophene-2-carboxylate |
| PubChem CID | 129208365 |
| Molecular Formula | C13H13F2NO3S |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | methyl 5-[(Z)-3-(3,3-difluoro-2-oxopyrrolidin-1-yl)prop-1-enyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1ccc(/C=C\CN2CCC(F)(F)C2=O)s1 |
| InChI | InChI=1S/C13H13F2NO3S/c1-19-11(17)10-5-4-9(20-10)3-2-7-16-8-6-13(14,15)12(16)18/h2-5H,6-8H2,1H3/b3-2- |
| InChIKey | SMKAELVGASOCFV-IHWYPQMZSA-N |
| XLogP | 2.42 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 5-[(Z)-3-(3,3-difluoro-2-oxopyrrolidin-1-yl)prop-1-enyl]thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[(Z)-3-(3,3-difluoro-2-oxopyrrolidin-1-yl)prop-1-enyl]thiophene-2-carboxylate?
The IUPAC name of methyl 5-[(Z)-3-(3,3-difluoro-2-oxopyrrolidin-1-yl)prop-1-enyl]thiophene-2-carboxylate (CID 129208365) is methyl 5-[(Z)-3-(3,3-difluoro-2-oxopyrrolidin-1-yl)prop-1-enyl]thiophene-2-carboxylate.
What is the SMILES notation for methyl 5-[(Z)-3-(3,3-difluoro-2-oxopyrrolidin-1-yl)prop-1-enyl]thiophene-2-carboxylate?
The canonical SMILES for methyl 5-[(Z)-3-(3,3-difluoro-2-oxopyrrolidin-1-yl)prop-1-enyl]thiophene-2-carboxylate is COC(=O)c1ccc(/C=C\CN2CCC(F)(F)C2=O)s1.
What is the InChIKey of methyl 5-[(Z)-3-(3,3-difluoro-2-oxopyrrolidin-1-yl)prop-1-enyl]thiophene-2-carboxylate?
The InChIKey is SMKAELVGASOCFV-IHWYPQMZSA-N. The full InChI is InChI=1S/C13H13F2NO3S/c1-19-11(17)10-5-4-9(20-10)3-2-7-16-8-6-13(14,15)12(16)18/h2-5H,6-8H2,1H3/b3-2-.
What are the key properties of methyl 5-[(Z)-3-(3,3-difluoro-2-oxopyrrolidin-1-yl)prop-1-enyl]thiophene-2-carboxylate?
methyl 5-[(Z)-3-(3,3-difluoro-2-oxopyrrolidin-1-yl)prop-1-enyl]thiophene-2-carboxylate has a molecular weight of 301.31 g/mol, XLogP of 2.42, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[(Z)-3-(3,3-difluoro-2-oxopyrrolidin-1-yl)prop-1-enyl]thiophene-2-carboxylate is sourced from PubChem (CID 129208365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).