C27H38N2 — CID 129208629
N-[(1E,3R)-2-butyl-3-methyl-1-[(6S)-4-propan-2-yl-3-bicyclo[4.1.0]hepta-1(7),2,4-trienyl]hepta-1,6-dienyl]-1,2-dihydropyridin-2-amine (PubChem CID 129208629) has the molecular formula C27H38N2 and a molecular weight of 390.62 g/mol. Its IUPAC name is N-[(1E,3R)-2-butyl-3-methyl-1-[(6S)-4-propan-2-yl-3-bicyclo[4.1.0]hepta-1(7),2,4-trienyl]hepta-1,6-dienyl]-1,2-dihydropyridin-2-amine.
| Compound Name | N-[(1E,3R)-2-butyl-3-methyl-1-[(6S)-4-propan-2-yl-3-bicyclo[4.1.0]hepta-1(7),2,4-trienyl]hepta-1,6-dienyl]-1,2-dihydropyridin-2-amine |
|---|---|
| PubChem CID | 129208629 |
| Molecular Formula | C27H38N2 |
| Molecular Weight | 390.62 g/mol |
| Exact Mass | 390.30 |
| IUPAC Name | N-[(1E,3R)-2-butyl-3-methyl-1-[(6S)-4-propan-2-yl-3-bicyclo[4.1.0]hepta-1(7),2,4-trienyl]hepta-1,6-dienyl]-1,2-dihydropyridin-2-amine |
| SMILES | C=CCC[C@@H](C)/C(CCCC)=C(/NC1C=CC=CN1)C1=CC2=C[C@H]2C=C1C(C)C |
| InChI | InChI=1S/C27H38N2/c1-6-8-12-20(5)23(13-9-7-2)27(29-26-14-10-11-15-28-26)25-18-22-16-21(22)17-24(25)19(3)4/h6,10-11,14-21,26,28-29H,1,7-9,12-13H2,2-5H3/b27-23+/t20-,21+,26?/m1/s1 |
| InChIKey | BGLIVHIATYHOFH-NEDCHYNSSA-N |
| XLogP | 6.70 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.62 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|