About N-[(E)-but-2-enyl]-1-[(4S)-4-methylcyclohexa-1,5-dien-1-yl]methanimine
N-[(E)-but-2-enyl]-1-[(4S)-4-methylcyclohexa-1,5-dien-1-yl]methanimine (PubChem CID 129208631) has the molecular formula C12H17N
and a molecular weight of 175.27 g/mol. Its IUPAC name is N-[(E)-but-2-enyl]-1-[(4S)-4-methylcyclohexa-1,5-dien-1-yl]methanimine.
Molecular Properties
| Compound Name | N-[(E)-but-2-enyl]-1-[(4S)-4-methylcyclohexa-1,5-dien-1-yl]methanimine |
| PubChem CID | 129208631 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | N-[(E)-but-2-enyl]-1-[(4S)-4-methylcyclohexa-1,5-dien-1-yl]methanimine |
| SMILES | C/C=C/C/N=C/C1=CC[C@H](C)C=C1 |
| InChI | InChI=1S/C12H17N/c1-3-4-9-13-10-12-7-5-11(2)6-8-12/h3-5,7-8,10-11H,6,9H2,1-2H3/b4-3+,13-10+/t11-/m1/s1 |
| InChIKey | YMSOAQJGDIULQE-QIDYMFRFSA-N |
| XLogP | 3.16 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-but-2-enyl]-1-[(4S)-4-methylcyclohexa-1,5-dien-1-yl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-but-2-enyl]-1-[(4S)-4-methylcyclohexa-1,5-dien-1-yl]methanimine?
The IUPAC name of N-[(E)-but-2-enyl]-1-[(4S)-4-methylcyclohexa-1,5-dien-1-yl]methanimine (CID 129208631) is N-[(E)-but-2-enyl]-1-[(4S)-4-methylcyclohexa-1,5-dien-1-yl]methanimine.
What is the SMILES notation for N-[(E)-but-2-enyl]-1-[(4S)-4-methylcyclohexa-1,5-dien-1-yl]methanimine?
The canonical SMILES for N-[(E)-but-2-enyl]-1-[(4S)-4-methylcyclohexa-1,5-dien-1-yl]methanimine is C/C=C/C/N=C/C1=CC[C@H](C)C=C1.
What is the InChIKey of N-[(E)-but-2-enyl]-1-[(4S)-4-methylcyclohexa-1,5-dien-1-yl]methanimine?
The InChIKey is YMSOAQJGDIULQE-QIDYMFRFSA-N. The full InChI is InChI=1S/C12H17N/c1-3-4-9-13-10-12-7-5-11(2)6-8-12/h3-5,7-8,10-11H,6,9H2,1-2H3/b4-3+,13-10+/t11-/m1/s1.
What are the key properties of N-[(E)-but-2-enyl]-1-[(4S)-4-methylcyclohexa-1,5-dien-1-yl]methanimine?
N-[(E)-but-2-enyl]-1-[(4S)-4-methylcyclohexa-1,5-dien-1-yl]methanimine has a molecular weight of 175.27 g/mol, XLogP of 3.16, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-but-2-enyl]-1-[(4S)-4-methylcyclohexa-1,5-dien-1-yl]methanimine is sourced from PubChem (CID 129208631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).