C47H37N3 — CID 129209452
(1Z,3Z)-1-(3,5-diphenylphenyl)-5-[(10Z)-9-methylidene-19-phenyl-2,19-diazatetracyclo[10.7.0.03,8.013,18]nonadeca-1(12),3,5,7,10,13,15,17-octaen-2-yl]penta-1,3-dien-1-amine (PubChem CID 129209452) has the molecular formula C47H37N3 and a molecular weight of 643.83 g/mol. Its IUPAC name is (1Z,3Z)-1-(3,5-diphenylphenyl)-5-[(10Z)-9-methylidene-19-phenyl-2,19-diazatetracyclo[10.7.0.03,8.013,18]nonadeca-1(12),3,5,7,10,13,15,17-octaen-2-yl]penta-1,3-dien-1-amine.
| Compound Name | (1Z,3Z)-1-(3,5-diphenylphenyl)-5-[(10Z)-9-methylidene-19-phenyl-2,19-diazatetracyclo[10.7.0.03,8.013,18]nonadeca-1(12),3,5,7,10,13,15,17-octaen-2-yl]penta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 129209452 |
| Molecular Formula | C47H37N3 |
| Molecular Weight | 643.83 g/mol |
| Exact Mass | 643.30 |
| IUPAC Name | (1Z,3Z)-1-(3,5-diphenylphenyl)-5-[(10Z)-9-methylidene-19-phenyl-2,19-diazatetracyclo[10.7.0.03,8.013,18]nonadeca-1(12),3,5,7,10,13,15,17-octaen-2-yl]penta-1,3-dien-1-amine |
| SMILES | C=C1/C=C\c2c(n(-c3ccccc3)c3ccccc23)N(C/C=C\C=C(/N)c2cc(-c3ccccc3)cc(-c3ccccc3)c2)c2ccccc21 |
| InChI | InChI=1S/C47H37N3/c1-34-28-29-43-42-24-12-14-27-46(42)50(40-21-9-4-10-22-40)47(43)49(45-26-13-11-23-41(34)45)30-16-15-25-44(48)39-32-37(35-17-5-2-6-18-35)31-38(33-39)36-19-7-3-8-20-36/h2-29,31-33H,1,30,48H2/b16-15-,29-28-,44-25- |
| InChIKey | YIQFKHIKRPHIDK-JGUAOBKUSA-N |
| XLogP | 11.70 |
| TPSA | 34.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.83 |
| LogP ≤ 5 | 11.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|