About N,1-dibutyl-2,6-dimethyl-4-oxopyridine-3-carboxamide
N,1-dibutyl-2,6-dimethyl-4-oxopyridine-3-carboxamide (PubChem CID 12920971) has the molecular formula C16H26N2O2
and a molecular weight of 278.40 g/mol. Its IUPAC name is N,1-dibutyl-2,6-dimethyl-4-oxopyridine-3-carboxamide.
Molecular Properties
| Compound Name | N,1-dibutyl-2,6-dimethyl-4-oxopyridine-3-carboxamide |
| PubChem CID | 12920971 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | N,1-dibutyl-2,6-dimethyl-4-oxopyridine-3-carboxamide |
| SMILES | CCCCNC(=O)c1c(C)n(CCCC)c(C)cc1=O |
| InChI | InChI=1S/C16H26N2O2/c1-5-7-9-17-16(20)15-13(4)18(10-8-6-2)12(3)11-14(15)19/h11H,5-10H2,1-4H3,(H,17,20) |
| InChIKey | QVGWUAJALZUURI-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N,1-dibutyl-2,6-dimethyl-4-oxopyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,1-dibutyl-2,6-dimethyl-4-oxopyridine-3-carboxamide?
The IUPAC name of N,1-dibutyl-2,6-dimethyl-4-oxopyridine-3-carboxamide (CID 12920971) is N,1-dibutyl-2,6-dimethyl-4-oxopyridine-3-carboxamide.
What is the SMILES notation for N,1-dibutyl-2,6-dimethyl-4-oxopyridine-3-carboxamide?
The canonical SMILES for N,1-dibutyl-2,6-dimethyl-4-oxopyridine-3-carboxamide is CCCCNC(=O)c1c(C)n(CCCC)c(C)cc1=O.
What is the InChIKey of N,1-dibutyl-2,6-dimethyl-4-oxopyridine-3-carboxamide?
The InChIKey is QVGWUAJALZUURI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N2O2/c1-5-7-9-17-16(20)15-13(4)18(10-8-6-2)12(3)11-14(15)19/h11H,5-10H2,1-4H3,(H,17,20).
What are the key properties of N,1-dibutyl-2,6-dimethyl-4-oxopyridine-3-carboxamide?
N,1-dibutyl-2,6-dimethyl-4-oxopyridine-3-carboxamide has a molecular weight of 278.40 g/mol, XLogP of 2.80, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,1-dibutyl-2,6-dimethyl-4-oxopyridine-3-carboxamide is sourced from PubChem (CID 12920971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).