C14H23N — CID 129210105
N-[(3E,5Z)-2,7-dimethylocta-3,5-dien-4-yl]but-3-en-1-imine (PubChem CID 129210105) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is N-[(3E,5Z)-2,7-dimethylocta-3,5-dien-4-yl]but-3-en-1-imine.
| Compound Name | N-[(3E,5Z)-2,7-dimethylocta-3,5-dien-4-yl]but-3-en-1-imine |
|---|---|
| PubChem CID | 129210105 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | N-[(3E,5Z)-2,7-dimethylocta-3,5-dien-4-yl]but-3-en-1-imine |
| SMILES | C=CC/C=N/C(/C=C\C(C)C)=C/C(C)C |
| InChI | InChI=1S/C14H23N/c1-6-7-10-15-14(11-13(4)5)9-8-12(2)3/h6,8-13H,1,7H2,2-5H3/b9-8-,14-11+,15-10+ |
| InChIKey | MRNYNTXDEZJKJV-SAWGNTFZSA-N |
| XLogP | 4.39 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|