About [[(Z,2S)-oct-6-en-2-yl]amino]methanol
[[(Z,2S)-oct-6-en-2-yl]amino]methanol (PubChem CID 129210241) has the molecular formula C9H19NO
and a molecular weight of 157.26 g/mol. Its IUPAC name is [[(Z,2S)-oct-6-en-2-yl]amino]methanol.
Molecular Properties
| Compound Name | [[(Z,2S)-oct-6-en-2-yl]amino]methanol |
| PubChem CID | 129210241 |
| Molecular Formula | C9H19NO |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.15 |
| IUPAC Name | [[(Z,2S)-oct-6-en-2-yl]amino]methanol |
| SMILES | C/C=C\CCC[C@H](C)NCO |
| InChI | InChI=1S/C9H19NO/c1-3-4-5-6-7-9(2)10-8-11/h3-4,9-11H,5-8H2,1-2H3/b4-3-/t9-/m0/s1 |
| InChIKey | FNWGFSDJXJQRPS-TYRPZCRBSA-N |
| XLogP | 1.66 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [[(Z,2S)-oct-6-en-2-yl]amino]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[(Z,2S)-oct-6-en-2-yl]amino]methanol?
The IUPAC name of [[(Z,2S)-oct-6-en-2-yl]amino]methanol (CID 129210241) is [[(Z,2S)-oct-6-en-2-yl]amino]methanol.
What is the SMILES notation for [[(Z,2S)-oct-6-en-2-yl]amino]methanol?
The canonical SMILES for [[(Z,2S)-oct-6-en-2-yl]amino]methanol is C/C=C\CCC[C@H](C)NCO.
What is the InChIKey of [[(Z,2S)-oct-6-en-2-yl]amino]methanol?
The InChIKey is FNWGFSDJXJQRPS-TYRPZCRBSA-N. The full InChI is InChI=1S/C9H19NO/c1-3-4-5-6-7-9(2)10-8-11/h3-4,9-11H,5-8H2,1-2H3/b4-3-/t9-/m0/s1.
What are the key properties of [[(Z,2S)-oct-6-en-2-yl]amino]methanol?
[[(Z,2S)-oct-6-en-2-yl]amino]methanol has a molecular weight of 157.26 g/mol, XLogP of 1.66, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [[(Z,2S)-oct-6-en-2-yl]amino]methanol is sourced from PubChem (CID 129210241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).