About 3-(5-methoxycyclohepta-1,4,6-trien-1-yl)pyrrolidine
3-(5-methoxycyclohepta-1,4,6-trien-1-yl)pyrrolidine (PubChem CID 129210426) has the molecular formula C12H17NO
and a molecular weight of 191.27 g/mol. Its IUPAC name is 3-(5-methoxycyclohepta-1,4,6-trien-1-yl)pyrrolidine.
Molecular Properties
| Compound Name | 3-(5-methoxycyclohepta-1,4,6-trien-1-yl)pyrrolidine |
| PubChem CID | 129210426 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 3-(5-methoxycyclohepta-1,4,6-trien-1-yl)pyrrolidine |
| SMILES | COC1=CCC=C(C2CCNC2)C=C1 |
| InChI | InChI=1S/C12H17NO/c1-14-12-4-2-3-10(5-6-12)11-7-8-13-9-11/h3-6,11,13H,2,7-9H2,1H3 |
| InChIKey | HVXQUEPHTXBTSX-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(5-methoxycyclohepta-1,4,6-trien-1-yl)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-methoxycyclohepta-1,4,6-trien-1-yl)pyrrolidine?
The IUPAC name of 3-(5-methoxycyclohepta-1,4,6-trien-1-yl)pyrrolidine (CID 129210426) is 3-(5-methoxycyclohepta-1,4,6-trien-1-yl)pyrrolidine.
What is the SMILES notation for 3-(5-methoxycyclohepta-1,4,6-trien-1-yl)pyrrolidine?
The canonical SMILES for 3-(5-methoxycyclohepta-1,4,6-trien-1-yl)pyrrolidine is COC1=CCC=C(C2CCNC2)C=C1.
What is the InChIKey of 3-(5-methoxycyclohepta-1,4,6-trien-1-yl)pyrrolidine?
The InChIKey is HVXQUEPHTXBTSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO/c1-14-12-4-2-3-10(5-6-12)11-7-8-13-9-11/h3-6,11,13H,2,7-9H2,1H3.
What are the key properties of 3-(5-methoxycyclohepta-1,4,6-trien-1-yl)pyrrolidine?
3-(5-methoxycyclohepta-1,4,6-trien-1-yl)pyrrolidine has a molecular weight of 191.27 g/mol, XLogP of 2.01, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-methoxycyclohepta-1,4,6-trien-1-yl)pyrrolidine is sourced from PubChem (CID 129210426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).