C27H47N3 — CID 129210471
(E)-N-ethyl-N-methyl-5-[[(9Z,11Z)-8-methyl-7-[(E)-prop-1-enyl]iminotetradeca-9,11-dien-6-ylidene]amino]hex-4-en-2-amine (PubChem CID 129210471) has the molecular formula C27H47N3 and a molecular weight of 413.69 g/mol. Its IUPAC name is (E)-N-ethyl-N-methyl-5-[[(9Z,11Z)-8-methyl-7-[(E)-prop-1-enyl]iminotetradeca-9,11-dien-6-ylidene]amino]hex-4-en-2-amine.
| Compound Name | (E)-N-ethyl-N-methyl-5-[[(9Z,11Z)-8-methyl-7-[(E)-prop-1-enyl]iminotetradeca-9,11-dien-6-ylidene]amino]hex-4-en-2-amine |
|---|---|
| PubChem CID | 129210471 |
| Molecular Formula | C27H47N3 |
| Molecular Weight | 413.69 g/mol |
| Exact Mass | 413.38 |
| IUPAC Name | (E)-N-ethyl-N-methyl-5-[[(9Z,11Z)-8-methyl-7-[(E)-prop-1-enyl]iminotetradeca-9,11-dien-6-ylidene]amino]hex-4-en-2-amine |
| SMILES | C/C=C/N=C(C(/CCCCC)=N/C(C)=C/CC(C)N(C)CC)\C(C)/C=C\C=C/CC |
| InChI | InChI=1S/C27H47N3/c1-9-13-15-17-18-23(5)27(28-22-11-3)26(19-16-14-10-2)29-24(6)20-21-25(7)30(8)12-4/h11,13,15,17-18,20,22-23,25H,9-10,12,14,16,19,21H2,1-8H3/b15-13-,18-17-,22-11+,24-20+,28-27+,29-26+ |
| InChIKey | USIADJCYKFYETH-IMNVUTRHSA-N |
| XLogP | 7.77 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.69 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|